What is the molar mass of aspirin c9h8o3?

3.1Computed Properties
Property Name Property Value
Molecular Weight 164.16
XLogP3 0.8
Hydrogen Bond Donor Count 1
Hydrogen Bond Acceptor Count 3

How do you find the mass of aspirin?

Calculate the mass of aspirin in each tablet according to the equation below. (MW of aspirin = 180 g/mole) Moles of aspirin × Molecular Weight of aspirin (in g/mole) = Mass of aspirin (in grams) 7.

What is the moles of aspirin?

So, aspirin, C9H8O4 , has a molar mass of 180.157 g mol−1 .

Which is the molar mass of acetylsalicylic acid aspirin C9H8O4?

180.157 g/mol
The molar mass of aspirin with a chemical formula of C9 H8 O4 is 180.157 g/mol.

How can molar mass be calculated?

To calculate the molar mass of a molecule, we first obtain the atomic weights from the individual elements in a periodic table. We then count the number of atoms and multiply it by the individual atomic masses. Lastly, we add all the atomic masses together to get the molar mass.

What is the molar mass of ibuprofen?

206.29 g/mol
Ibuprofen / Molar mass

What is the structural formula and molar mass of aspirin?

Identification of Aspirin Chemical Compound
Chemical Formula C9H8O4
Molecular Weight 180.15742 g/mol
IUPAC Name 2-(acetyloxy)benzoic acid
SMILES String CC(=O)Oc1ccccc1C(O)=O
InChI InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)

What is the molar mass of citric acid?

192.124 g/mol
Citric acid / Molar mass

What is the molar mass of sodium carbonate na2co3 )?

105.9888 g/mol
Sodium carbonate / Molar mass

What is structure of aspirin?

C₉H₈O₄
Aspirin / Formula

What is the C in aspirin by mass in aspirin?

Problem: Aspirin has the following mass percent composition: C 60.00%, H 4.48%, and O 35.52%.

What is the structural formula of propane?

C₃H₈
Propane / Formula

Chemical formula for propane gas

The propane chemical structure, or chemical formula, is three carbon atoms branched with eight hydrogen atoms (C3H8).

How is aspirin metabolised?

Let’s look at aspirin as example of a medicine being metabolised. Aspirin undergoes phase 1 hydrolysis to salicylic acid. In phase 2 it is congugated with either glycine or glucoronic acid forming a range of ionised metabolytes that can then be excreted in the urine.

Is aspirin an antiplatelet?

Most people who have had a cardiac event take an antiplatelet medicine. Antiplatelets include: ASA, also called acetylsalicylic acid (Aspirin, Asaphen, Entrophen, Novasen) Clopidogrel (Plavix)

What is the shape of aspirin?

Aspirin: Summary in Tabular Form
Aspirin
Chemical formula CH3COOC6H4COOH or C9H8O4
Appearance White crystalline
Odor Like vinegar (at higher concentrations)
State at STP Solid

Is aspirin metabolized by CYP450?

Aspirin is metabolized by three key enzymes, UDP-glucuronosyltransferase 1A6 (UGT1A6), cytochrome P450 2C9 (CYP2C9), and N-acetyl transferase 2 (NAT2). Each of these enzymes is known to have genetic polymorphisms. … No significant association was found with the other two enzymes, UGT1A6 and NAT2.

How does aspirin work as an antiplatelet?

Aspirin works by irreversibly inhibiting the enzyme cyclo-oxygenase (COX-1) which is required to make the precursors of thromboxane within platelets. This reduces thromboxane synthesis. Thromboxane is required to facilitate platelet aggregation and to stimulate further platelet activation.

What affects pharmacokinetics of aspirin?

Pharmacology/Pharmacokinetics

Aspirin is rapidly absorbed in the upper gastrointestinal (GI) tract and results in a measurable inhibition of platelet function within 60 minutes. This antiplatelet effect is associated with prolongation of the bleeding time and inhibition of TXA2-dependent platelet aggregation.